Soluble in many organic solvents, such as ethanol, dimethylformamide and chloroform, it is relatively stable in air and does not decompose easily under strong acid and alkali conditions.
2,3-Difluoro-5-chloropyridine is an important intermediate for the synthesis of the highly effective pesticide acetonitrile. Fluorinated pesticides have been developed rapidly in the past decade, and have become the focus of the world pesticide industry, among which there are fluorinated pyrethroids and fluorinated benzoylureas with more development and application.
5-Chloro-2,3-Difluoropyridine (CDFP) is a specialized halogenated pyridine derivative commonly used as an intermediate in pharmaceutical and agrochemical synthesis. Its unique structure, incorporating chlorine and fluorine atoms, provides enhanced reactivity and versatility in organic synthesis.
Melting point | 47-49 C |
Boiling point | 135°C |
density | 1.442 g/mL at 25 °C |
refractive index | 1.4738 |
Fp | 135°C |
storage temp. | 2-8°C |
solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
pka | -5.14±0.20(Predicted) |
form | Oil |
color | Clear Colourless |
BRN | 4177319 |
InChI | InChI=1S/C5H2ClF2N/c6-3-1-4(7)5(8)9-2-3/h1-2H |
InChIKey | PERMDYZFNQIKBL-UHFFFAOYSA-N |
SMILES | C1(F)=NC=C(Cl)C=C1F |
CAS DataBase Reference | 89402-43-7(CAS DataBase Reference) |
Pharmaceutical Intermediates:
CDFP is widely utilized in the synthesis of active pharmaceutical ingredients (APIs). Its halogenated structure makes it suitable for introducing reactive sites in complex molecules.
Agrochemical Synthesis:
The compound is a key intermediate in the production of herbicides, fungicides, and insecticides. Its fluorinated structure contributes to the bioactivity and stability of agrochemical products.
Organic Synthesis:
CDFP serves as a versatile building block in various organic transformations, including cross-coupling reactions (e.g., Suzuki or Heck reactions) to create more complex aromatic and heterocyclic compounds.
Material Science:
The unique properties of CDFP make it valuable in the development of advanced materials, such as fluorinated polymers or specialty coatings.
The halogen atoms in 5-Chloro-2,3-Difluoropyridine enhance its reactivity, particularly in nucleophilic substitution and cross-coupling reactions. This allows for the efficient introduction of functional groups or the formation of carbon-carbon and carbon-heteroatom bonds, which are critical in the development of pharmaceuticals and agrochemicals.
5-Chloro-2,3-Difluoropyridine is a reactive chemical that requires careful handling to ensure safety.
Protective Equipment:
Always wear gloves, safety goggles, and appropriate lab attire when handling CDFP. Use in a well-ventilated area or fume hood to minimize inhalation exposure.
Storage:
Store in a cool, dry place, away from moisture, heat, and incompatible materials. Keep containers tightly closed when not in use.
Hazards:
Inhalation: Vapors may cause respiratory irritation.
Skin Contact: Can cause irritation upon contact.
Eye Contact: May cause serious eye irritation.
Ingestion: Harmful if swallowed.
First Aid Measures:
Inhalation: Move to fresh air and seek medical attention if symptoms persist.
Skin Contact: Wash thoroughly with soap and water.
Eye Contact: Rinse cautiously with water for several minutes and seek medical attention.
Ingestion: Do not induce vomiting; seek immediate medical attention.
5-Chloro-2,3-Difluoropyridine (CDFP) is a highly reactive and versatile compound, essential in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. With its halogenated pyridine structure, it enables efficient and precise chemical transformations, making it a valuable asset in industrial and research applications. Proper handling and storage are critical to ensure safety and maintain product integrity.
1. What is the primary use of 5-Chloro-2,3-Difluoropyridine?
It is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals.
2. Is CDFP soluble in water?
It has limited solubility in water but is readily soluble in most organic solvents.
3. What precautions should be taken when handling CDFP?
Wear protective gear, use in a well-ventilated area, and avoid direct contact with skin, eyes, or inhalation of vapors.
4. Can CDFP be used in cross-coupling reactions?
Yes, its halogenated structure makes it suitable for reactions like Suzuki and Heck coupling.
5. What are the storage requirements for CDFP?
Store in a cool, dry place, away from moisture and incompatible substances, in tightly sealed containers.